Sample size determination: Difference between revisions
en>Melcombe →Small sample sizes: remove section as off-topic |
en>Likelihoodist |
||
| Line 1: | Line 1: | ||
{{chembox | |||
| verifiedrevid = 400101721 | |||
| ImageFile = Guanidinium nitrate.png | |||
| ImageSize = 200px | |||
| ImageFile1 = Guanidine-nitrate-3D-balls.png | |||
| ImageName1 = Ball-and-stick models of the constituent ions | |||
| IUPACName = Guanidinium nitrate | |||
| OtherNames = | |||
| Section1 = {{Chembox Identifiers | |||
| Abbreviations = | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 10049 | |||
| InChI = 1/CH5N3.HNO3/c2*2-1(3)4/h(H5,2,3,4);(H,2,3,4) | |||
| InChIKey = CNUNWZZSUJPAHX-UHFFFAOYAZ | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChI = 1S/CH5N3.HNO3/c2*2-1(3)4/h(H5,2,3,4);(H,2,3,4) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | |||
| StdInChIKey = CNUNWZZSUJPAHX-UHFFFAOYSA-N | |||
| CASNo = 506-93-4 | |||
| EINECS = 208-060-1 | |||
| PubChem = 10481 | |||
| SMILES = [O-][N+](=O)O.[N@H]=C(N)N | |||
| InChI = | |||
| RTECS = | |||
| MeSHName = | |||
| ChEBI = | |||
| KEGG = | |||
| ATCCode_prefix = | |||
| ATCCode_suffix = | |||
| ATC_Supplemental =}} | |||
| Section2 = {{Chembox Properties | |||
| Formula = CH<sub>6</sub>N<sub>4</sub>O<sub>3</sub> | |||
| MolarMass = | |||
| Appearance = White solid | |||
| Density = 1.436 g/cm<sup>3</sup> | |||
| MeltingPtC = 213 | |||
| Melting_notes = | |||
| BoilingPt = | |||
| Boiling_notes = Decomposes below boiling point | |||
| Solubility = 160 g/l at 20 °C | |||
| SolubleOther = | |||
| Solvent = | |||
| pKa = | |||
| pKb = }} | |||
| Section7 = {{Chembox Hazards | |||
| ExternalMSDS = [http://www.ilo.org/public/english/protection/safework/cis/products/icsc/dtasht/_icsc05/icsc0561.pdf MSDS] | |||
| EUClass = {{Hazchem O}} | |||
| EUIndex = | |||
| MainHazards = | |||
| NFPA-H = 2 | |||
| NFPA-F = 1 | |||
| NFPA-R = 4 | |||
| NFPA-O = E | |||
| RPhrases = {{R20}} {{R21}} {{R22}} {{R36}} {{R38}} | |||
| SPhrases = | |||
| RSPhrases = | |||
| FlashPt = | |||
| Autoignition = | |||
| ExploLimits = | |||
| PEL = }} | |||
}} | |||
'''Guanidine nitrate''' is a high energy fuel used in some [[gas generator]] and [[solid rocket]] propellant applications. | |||
==Overview== | |||
Guanidine nitrate is the [[salt (chemistry)|salt]] formed from [[guanidine]] and [[nitric acid]]. It has the chemical formula C(NH<sub>2</sub>)<sub>3</sub>NO<sub>3</sub>. It has been used as a [[monopropellant]] in the [[Jetex engine]] for [[model airplane]]s. It is attractive because it has a high gas output and low flame temperature. It has a relatively high monopropellant [[specific impulse]] of 177 seconds (<math>1.7 kN\ x\ \tfrac {s}{kg}</math>).<ref group="note" >1000 lbf/in² (700 kPa) chamber pressure, 14.7 lbf/in² (101 kPa) exit pressure, shifting equilibrium theoretical performance</ref> | |||
==Safety== | |||
Hazards: | |||
*May explosively decompose on shock, friction, or concussion. | |||
*May explode on heating. | |||
*On combustion, forms toxic and corrosive fumes including nitric acid and nitrogen oxides. | |||
*The substance is a strong oxidant and reacts with combustible and reducing materials. | |||
Routes of exposure: | |||
*The substance can be absorbed into the body by ingestion. | |||
*A nuisance-causing concentration of airborne particles can be reached quickly when dispersed, especially if powdered. | |||
Effects of short-term exposure: | |||
*The substance is severely irritating to the eyes and the skin. | |||
*Harmful if inhaled, swallowed or absorbed through the skin. | |||
== See also == | |||
* [[Nitroguanidine]] | |||
==Notes== | |||
{{Reflist|group=note|liststyle=lower-roman}} | |||
{{Reflist}} | |||
==External links== | |||
*Jetex: [http://jetex.org/motors/propellants.html Propellants] | |||
*PhysChem: [http://physchem.ox.ac.uk/MSDS/GU/guanidine_nitrate.html Guanidine Nitrate] MSDS | |||
[[Category:Guanidines]] | |||
[[Category:Nitrates]] | |||
[[Category:Rocket fuels]] | |||
Revision as of 01:58, 14 January 2014
Guanidine nitrate is a high energy fuel used in some gas generator and solid rocket propellant applications.
Overview
Guanidine nitrate is the salt formed from guanidine and nitric acid. It has the chemical formula C(NH2)3NO3. It has been used as a monopropellant in the Jetex engine for model airplanes. It is attractive because it has a high gas output and low flame temperature. It has a relatively high monopropellant specific impulse of 177 seconds ().[note 1]
Safety
Hazards:
- May explosively decompose on shock, friction, or concussion.
- May explode on heating.
- On combustion, forms toxic and corrosive fumes including nitric acid and nitrogen oxides.
- The substance is a strong oxidant and reacts with combustible and reducing materials.
Routes of exposure:
- The substance can be absorbed into the body by ingestion.
- A nuisance-causing concentration of airborne particles can be reached quickly when dispersed, especially if powdered.
Effects of short-term exposure:
- The substance is severely irritating to the eyes and the skin.
- Harmful if inhaled, swallowed or absorbed through the skin.
See also
Notes
43 year old Petroleum Engineer Harry from Deep River, usually spends time with hobbies and interests like renting movies, property developers in singapore new condominium and vehicle racing. Constantly enjoys going to destinations like Camino Real de Tierra Adentro.
43 year old Petroleum Engineer Harry from Deep River, usually spends time with hobbies and interests like renting movies, property developers in singapore new condominium and vehicle racing. Constantly enjoys going to destinations like Camino Real de Tierra Adentro.
External links
- Jetex: Propellants
- PhysChem: Guanidine Nitrate MSDS
Cite error: <ref> tags exist for a group named "note", but no corresponding <references group="note"/> tag was found